LBF18306SC05
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0184 |
| LipidMaps | LMFA01030145 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18306SC05.mol |
| beta-Calendic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | trans-8, trans-10, trans-12-Octadecatrienoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCCC=CC=CC=CCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 77-78°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in ethanol, CS2, ether, heptane, metylalcohol and petroleum ether.<<0123>><<0279>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
