LBF18304SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0181 |
| LipidMaps | LMFA01030142 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18304SC01.mol |
| |
| Structural Information | |
| Systematic Name | 6, 10, 14-Octadecatrienoic acid |
| Common Name | |
| Symbol | |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCC=CCCC=CCCC=CCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | dX420 0.9221 |
| Optical Rotation | 1.4794 at 20°C |
| Reflactive Index | |
| Solubility | soluble in ethanol, pentane and petroleum ether.<<0495>><<0498>><<0499>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
