LBF18210SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0153 |
| LipidMaps | LMFA01030114 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18210SC01.mol |
| |
| Structural Information | |
| Systematic Name | 6, 8-Octadecadienoic acid |
| Common Name | |
| Symbol | |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCCCCCC=CC=CCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | 153°C to 155°C at 0.1mmHg |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | <<0138>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
