LBF18208HP01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8048 |
LipidMaps | LMFA01040036 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18208HP01.mol |
![]() | |
Structural Information | |
Systematic Name | Methyl 9-Butylperoxy-10,12-Octadecadienoate |
Common Name | |
Symbol | |
Formula | C23H42O4 |
Exact Mass | 382.30830983199996 |
Average Mass | 382.57718 |
SMILES | C(CCCC(=O)OC)CCCC(OOC(C)(C)C)C=CC=CCCCCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(hydrogenation with palladium-charcoal)<<8057>> |
UV Spectra | lether/max=234nm<<8057>> |
IR Spectra | Ester carbonyl(1740cm-1), trans, trans diene(991cm-1)<<8057>> |
NMR Spectra | 1H-NMR<<8057>>: C10-C13(5.5-6.1ppm), C9(4.1ppm), C14(2.1ppm) |
Chromatograms |