LBF18109HO01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0374 |
LipidMaps | LMFA01050108 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18109HO01.mol |
Ricinoleic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 12-Hydroxy-cis-9-octadecenoic acid |
Common Name |
|
Symbol | |
Formula | C18H34O3 |
Exact Mass | 298.25079495399996 |
Average Mass | 298.46076 |
SMILES | CCCCCCC(O)CC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 5.0, 7.7 and 16.0°C (trimorphic) |
Boiling Point | 225°C at 10 mm Hg |
Density | d27.440.940 |
Optical Rotation | 1.4716 at 20°C |
Reflactive Index | |
Solubility | soluble in acetone, ethanol, ether ; slightly soluble in chloroform ; insoluble in water. <<0148>>/<<0197>>/<<0228>>/<<0284>>/<<0345>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |