Ginsenoside M7cd
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 69987-14-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Ginsenoside M7cd.mol |
| Ginsenoside M7cd | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (3beta,6alpha,12beta)-3,6,12,24-Tetrahydroxydammar-25-en-20-yl beta-D-glucopyranoside |
| Common Name |
|
| Symbol | |
| Formula | C36H62O10 |
| Exact Mass | 654.434298204 |
| Average Mass | 654.87148 |
| SMILES | OC(C(C)=C)CCC(OC(C5O)OC(C(O)C5O)CO)(C)C(C4)C(C3O)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Spectroscopic Data
| 13C-NMR (C5D5N, 25.15MHz) | C-1) 39.3, (2) 28.0, (3) 78.4, (4) 40.2, (5) 61.7, (6) 67.6, (7) 47.3, (8) 41.1, (9) 49.8, (10) 39.3, (11) 30.8, (12) 70.4, (13) 48.8, (14) 51.4, (15) 30.8, (16) 26.6, (17) 52.0, 52.3, (18) 17.4, (19) 17.4, (20) 83.2, 83.4, (21) 22.8, (22) 32.3, 32.5, (23) 30.8, (24) 75.6, 76.1, (25) 149.7, (26) 109.9, 110.2, (27) 18.5, 18.2, (28) 31.8, (29) 16.4, (30) 17.4 Glc (1) 98.2, (2) 75.1, (3) 78.7, (4) 71.4, (5) 78.2, (6) 62.8.
The doubling of same peaks is due to the presence of two C-24-epimers. |
O. Tanaka et al., Chem.Pharm.Bull., 27, 88 (1979).
