FLIA2GNS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIA2G 6,7,3',4',5'-Pentamethoxyisoflavone and O-methyl derivatives (2 pages) : FLIA2GNS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 24203-70-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA2GNS0001.mol |
| 6,7,3'-Trimethoxy-4',5'-methylenedioxyisoflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6,7,3'-Trimethoxy-4',5'-methylenedioxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C19H16O7 |
| Exact Mass | 356.089602866 |
| Average Mass | 356.32614 |
| SMILES | c(c(OC)4)(OC)cc(c3c4)OC=C(C3=O)c(c2)cc(c(c(OC)2)1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
