FLIA1ANS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIA1A Daidzein and O-methyl derivatives (35 pages) : FLIA1ANS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 486-66-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA1ANS0002.mol |
| Daidzein | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-3- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C15H10O4 |
| Exact Mass | 254.05790880799998 |
| Average Mass | 254.2375 |
| SMILES | Oc(c3)ccc(c3)C(=C1)C(=O)c(c2)c(cc(O)c2)O1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
