FL5FFCNSS001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FFC Gossypetin and O-methyl derivatives (94 pages) : FL5FFCNS Simple substitution (37 pages) : FL5FFCNSS Sulfate incluted (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | - |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FFCNSS001.mol |
| Gossypetin 3-O-sulfate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,8,3',4'-Hexahydroxyflavone 3-O-sulfate |
| Common Name |
|
| Symbol | |
| Formula | C15H10O11S |
| Exact Mass | 397.994381852 |
| Average Mass | 398.2993 |
| SMILES | Oc(c3)c(O)cc(c3)C(O1)=C(OS(O)(=O)=O)C(=O)c(c(O)2)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
