FL5FECGA0003
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEC Quercetagetin and O-methyl derivatives (150 pages) : FL5FECGA 3-Galactoside and related (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 128351-80-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FECGA0003.mol | 
| Quercetagetin 3'-methyl ether 3-galactoside | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 3,5,6,7,4'-Pentahydroxy-3'-methoxyflavone 3-galactoside | 
| Common Name | 
  | 
| Symbol | |
| Formula | C22H22O13 | 
| Exact Mass | 494.10604078999995 | 
| Average Mass | 494.40228 | 
| SMILES |  O(C(C3=O)=C(c(c4)cc(OC)c(O)c4)Oc(c23)cc(c(c2O)O)O) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
  | 
