FL2F1ANP0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F1A Liquiritigenin and O-methyl derivatives (43 pages) : FL2F1ANP Pyranoflavonoid (10 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 77263-09-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F1ANP0002.mol |
| Abyssinone III | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-5'-C-prenyl-6",6"-dimethylpyrano [ 2",3":4',3' ] flavanone |
| Common Name |
|
| Symbol | |
| Formula | C25H26O4 |
| Exact Mass | 390.18310931999997 |
| Average Mass | 390.47153999999995 |
| SMILES | CC(C)=CCc(c2)c(O1)c(cc2C(C4)Oc(c(C4=O)3)cc(O)cc3)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
