FL1A19NF0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1A Aurone : FL1A19 6,(3'),(5')-Hydroxyaurone and O-methyl derivatives (0 pages) : FL1A19NF Furanoflavonoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 61755-74-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1A19NF0001.mol |
| Furano [ 2",3":6,7 ] aurone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Furano [ 2",3":6,7 ] aurone |
| Common Name |
|
| Symbol | |
| Formula | C17H10O3 |
| Exact Mass | 262.06299418599997 |
| Average Mass | 262.2595 |
| SMILES | c(c4)ccc(c4)C=c(o1)c(=O)c(c2)c1c(c3)c(oc3)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
