BMAXS6ANk004
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 997-68-2 |
KEGG | C00449 |
KNApSAcK | |
CDX file | |
MOL file | BMAXS6ANk004.mol |
N6-(L-1,3-Dicarboxypropyl)-L-lysine | |
---|---|
![]() | |
Structural Information | |
Systematic Name | L-Saccharopine |
Common Name |
|
Symbol | |
Formula | C11H20N2O6 |
Exact Mass | 276.1321 |
Average Mass | 276.2863 |
SMILES | OC(=O)CC[C@H](NCCCC[C@H](N)C(O)=O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways