FL631ANS0001
From Metabolomics.JP
				
								
				(Redirected from INCHI:RHYGXRGFSFQNLC-DZGCQCFKSA-N)
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL631A Guibourtinidol and O-methyl derivatives (3 pages) : FL631ANS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 251909-54-3 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL631ANS0001.mol | 
| Guibourtinidol | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | (2R,3S) -4',7-Dihydroxyflavan-3-ol | 
| Common Name | 
 | 
| Symbol | |
| Formula | C15H14O4 | 
| Exact Mass | 258.089208936 | 
| Average Mass | 258.26926000000003 | 
| SMILES | Oc(c3)ccc(c3)C(O1)C(O)Cc(c2)c(cc(O)c2)1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
