FL6D1CNS0003
From Metabolomics.JP
(Redirected from INCHI:OFZBQQUVMQGHDJ-RBSFLKMASA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL6D Flavan 3,4-diol : FL6D1C Fisetinidol 4-ol, Epifisetinidol 4-ol and O-methyl derivatives (6 pages) : FL6D1CNS Simple substitution (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 64439-33-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6D1CNS0003.mol |
| Epifisetinidol-4alpha-ol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3R,4R) -3,4,7,3',4'-Pentahydroxyflavan |
| Common Name |
|
| Symbol | |
| Formula | C15H14O6 |
| Exact Mass | 290.07903818 |
| Average Mass | 290.26806 |
| SMILES | Oc(c3)cc(O1)c(c3)C(O)C(O)C1c(c2)cc(O)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
