FL1DE9NP0001
From Metabolomics.JP
(Redirected from INCHI:LJNJHJBBLPMBSN-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1D Dihydrochalcone : FL1DE9 (3),(5),2',3',4',6'-Hydroxydihydrochalcone and O-methyl derivatives (6 pages) : FL1DE9NP Pyranoflavonoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 84435-30-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DE9NP0001.mol |
| Flemistrictin D | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1- (5,8-Dihydroxy-7-methoxy-2,2-dimethyl-2H-1-benzopyran-6-yl) -3-phenylpropan-1-one |
| Common Name |
|
| Symbol | |
| Formula | C21H22O5 |
| Exact Mass | 354.146723814 |
| Average Mass | 354.39638 |
| SMILES | COc(c(O)2)c(c(O)c(C=3)c2OC(C3)(C)C)C(=O)CCc(c1)ccc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
