FL5FAAGS0018
From Metabolomics.JP
(Redirected from INCHI:KTZDZZQLJUYTES-BBIYZJLNSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAA Kaempferol (349 pages) : FL5FAAGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (140 pages) : FL5FAAGS0 Normal (138 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 65063-32-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FAAGS0018.mol |
| Kaempferol 4'-rhamnoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,4'-Tetrahydroxyflavone 4'-rhamnoside |
| Common Name |
|
| Symbol | |
| Formula | C21H20O10 |
| Exact Mass | 432.10564686 |
| Average Mass | 432.37749999999994 |
| SMILES | c(c3)(ccc(OC(O4)C(O)C(O)C(O)C(C)4)c3)C(=C2O)Oc(c1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
