FLIFALNP0001
From Metabolomics.JP
(Redirected from INCHI:JLTNCZQNGBLBGO-MOPGFXCFSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIF Rotenoid : FLIFAL (1),(2),3,(4),9,11-Hydroxyrotenone and O-methyl derivatives (4 pages) : FLIFALNP Pyranoflavonoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 82-09-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIFALNP0001.mol |
| Toxicarin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (7aS,13aS) -13,13a-Dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-3H-bis [ 1 ] benzopyrano [ 3,4-b:6',5'-e ] pyran-7 (7aH) -one |
| Common Name |
|
| Symbol | |
| Formula | C23H22O7 |
| Exact Mass | 410.136553058 |
| Average Mass | 410.41658000000007 |
| SMILES | [H][C@@]([C@]4([H])3)(c(c5)c(cc(c5OC)OC)OC4)C(=O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
