FL1CQUNS0001
From Metabolomics.JP
(Redirected from INCHI:HYSJQRYYQGEYMY-BQYQJAHWSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CQU Quinochalcone (14 pages) : FL1CQUNS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 5064-02-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CQUNS0001.mol |
| Pedicinin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,5-Dihydroxy-3-methoxy-6- [ (E) -1-oxo-3-phenyl-2-propenyl ] cyclohexa-2,5-diene-1,4-dione |
| Common Name |
|
| Symbol | |
| Formula | C16H12O6 |
| Exact Mass | 300.063388116 |
| Average Mass | 300.26288 |
| SMILES | COc(c(O)1)c(=O)c(O)c(C(=O)C=Cc(c2)cccc2)c(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
