FL2FF9NS0006
From Metabolomics.JP
(Redirected from INCHI:CQNKQOFKXLLWRE-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FF9 5,7,8,(3'),(5')-Hydroxyflavanone and O-methyl derivatives (13 pages) : FL2FF9NS Simple substitution (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 69616-73-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FF9NS0006.mol |
| 5,7,8-Trimethoxyflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,8-Trimethoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C18H18O5 |
| Exact Mass | 314.115423686 |
| Average Mass | 314.33252 |
| SMILES | O(C2c(c3)cccc3)c(c1OC)c(C(=O)C2)c(OC)cc1OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
