FLIBALNP0004
From Metabolomics.JP
(Redirected from CAS:63006-48-4)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIB Isoflavanone : FLIBAL 5,7,2',(3'),4',(5'),(6')-Trihydroxyisoflavanone and O-methyl derivatives (28 pages) : FLIBALNP Pyranoflavonoid (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 63006-48-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIBALNP0004.mol |
| Cajanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7- [ 2,4-Dihydroxy-5- (3-methyl-2-butenyl) phenyl ] -7,8-dihydro-5-hydroxy-2,2-dimethyl-2H,6H-benzo [ 1,2-b:5,4-b' ] dipyran-6-one |
| Common Name |
|
| Symbol | |
| Formula | C25H26O6 |
| Exact Mass | 422.172938564 |
| Average Mass | 422.47033999999996 |
| SMILES | O(c42)CC(C(=O)c2c(O)c(C=3)c(c4)OC(C3)(C)C)c(c1O)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
