FL2F1ANS0002
From Metabolomics.JP
(Redirected from CAS:61504-06-1)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F1A Liquiritigenin and O-methyl derivatives (43 pages) : FL2F1ANS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 61504-06-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F1ANS0002.mol |
| Methyl-liquiritigenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S) -2,3-Dihydro-7-methoxy-2alpha- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C16H14O4 |
| Exact Mass | 270.089208936 |
| Average Mass | 270.27996 |
| SMILES | COc(c3)cc(O1)c(c3)C(=O)CC1c(c2)ccc(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
