FL6D3ANS0005
From Metabolomics.JP
(Redirected from CAS:38412-80-5)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL6D Flavan 3,4-diol : FL6D3A Oritin 4-ol, Epioritin 4-ol and O-methyl derivatives (4 pages) : FL6D3ANS Simple substitution (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 38412-80-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6D3ANS0005.mol |
| Epioritin-4alpha-ol 8-methyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3R,4R) -3,4,7,4'-Tetrahydroxy-8-methoxyflavan |
| Common Name |
|
| Symbol | |
| Formula | C16H16O6 |
| Exact Mass | 304.094688244 |
| Average Mass | 304.29463999999996 |
| SMILES | COc(c(O)3)c(O1)c(cc3)[C@@H](O)[C@@H](O)[C@H]1c(c2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
