FL2FALNI0016
From Metabolomics.JP
(Redirected from CAS:144161-81-9)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAL 5,7,2',(3'),4',(5'),(6')-Hydroxyflavanone and O-methyl derivatives (78 pages) : FL2FALNI Non-cyclic prenyl substituted (40 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 144161-81-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FALNI0016.mol |
| Kenusanone D | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S) -2,3-Dihydro-8- (3-methyl-2-butenyl) -2alpha- (2,6-dihydroxy-4-methoxyphenyl) -5,7-dihydroxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C21H22O7 |
| Exact Mass | 386.136553058 |
| Average Mass | 386.39518 |
| SMILES | O(C(c(c3O)c(cc(c3)OC)O)2)c(c(CC=C(C)C)1)c(C(=O)C2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
