FLNAFCNS0003
From Metabolomics.JP
(Redirected from CAS:126633-46-3)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLNA 4-Arylcoumarin : FLNAFC 5,7,8,3',4'-Pentahydroxy-4-phenylcoumarin and O-methyl derivatives (4 pages) : FLNAFCNS Simple substitution (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 126633-46-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNAFCNS0003.mol |
| 8-Hydroxy-5,7,3',4'-tetramethoxy-4-phenylcoumarin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8-Hydroxy-5,7,3',4'-tetramethoxy-4-phenylcoumarin |
| Common Name |
|
| Symbol | |
| Formula | C19H18O7 |
| Exact Mass | 358.10525293 |
| Average Mass | 358.34202000000005 |
| SMILES | c(c3O)(OC)cc(c(c31)C(c(c2)cc(OC)c(OC)c2)=CC(=O)O1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
