LBF18305SC03
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0187 |
LipidMaps | LMFA01030148 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18305SC03.mol |
Structural Information | |
---|---|
Systematic Name | trans-9, trans-11, trans-13-Octadecatrienoic acid |
Common Name | |
Symbol | |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | CCCCC=CC=CC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 61.5-62.5°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone, ethanol, CS2, heptane, methylalcohol and pentane.<<0131>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |