FLIF1LNF0005
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIF Rotenoid : FLIF1L (1),(2),3,(4),9-Hydroxyrotenone and O-methyl derivatives (19 pages) : FLIF1LNF Furanoflavonoid (9 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 22256-05-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIF1LNF0005.mol |
| Isomillettone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R) -2,3,4abeta,11bbeta-Tetrahydro-2- (1-methylethenyl) [ 1,3 ] dioxolo [ 6,7 ] [ 1 ] benzopyrano [ 3,4-b ] furo [ 2,3-h ] [ 1 ] benzopyran-12 (5H) -one |
| Common Name |
|
| Symbol | |
| Formula | C22H18O6 |
| Exact Mass | 378.110338308 |
| Average Mass | 378.37472 |
| SMILES | c(c62)(C(C5CO6)C(=O)c(c4O5)ccc(c43)OC(C(C)=C)C3)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
