FL5FABGS0011
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAB Kaempferide (50 pages) : FL5FABGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 194657-34-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FABGS0011.mol |
| Kaempferol 4'-methyl ether 3- (4Rha-rhamnosylrutinoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- [ (O-6-Deoxy-alpha-L-mannopyranosyl- (1->4) -O-6-deoxy-alpha-L-mannopyranosyl- (1->6) -beta-D-glucopyranosyl) oxy ] -5,7-dihydroxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C34H42O19 |
| Exact Mass | 754.2320291619999 |
| Average Mass | 754.68588 |
| SMILES | C(O6)(C(O)C(O)C(C6C)OC(C5O)OC(C)C(C5O)O)OCC(C(O)1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
