FL1BACNS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1B Auronol : FL1BAC Alphitonin (0 pages) : FL1BACNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 493-36-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1BACNS0001.mol |
| Alphitonin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- [ (3,4-Dihydroxyphenyl) methyl ] -2,4,6-trihydroxy-3 (2H) -benzofuranone |
| Common Name |
|
| Symbol | |
| Formula | C15H12O7 |
| Exact Mass | 304.058302738 |
| Average Mass | 304.25158 |
| SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)C(O)(Cc(c2)cc(O)c(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
