FL63ACNC0006
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL63AC Catechin and Epicatechin (75 pages) : FL63ACNC Flavonoid substituted by complex substituent (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 280576-19-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL63ACNC0006.mol | 
| (-) -Amurensisin | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 2- [ (2R,3R) -3,4-dihydro-3,5,7-trihydroxy-2H-1-benzopyran-2-yl ] -4,8,9,10-tetrahydroxy-6H-Dibenzo [ b,d ] pyran-6-one | 
| Common Name | 
  | 
| Symbol | |
| Formula | C22H16O10 | 
| Exact Mass | 440.074346732 | 
| Average Mass | 440.35644 | 
| SMILES |  O(c12)C(c(c5)cc(c34)c(c(O)5)OC(c3cc(c(c4O)O)O)=O)C | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
