BMFYB4HOa001
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C05997 |
KNApSAcK | |
CDX file | |
MOL file | BMFYB4HOa001.mol |
3-Hydroxyisopentyl-CoA | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3-Hydroxy-isopentyl-CoA |
Common Name |
|
Symbol | |
Formula | C26H44N7O18P3S |
Exact Mass | 867.1676 |
Average Mass | 867.6512 |
SMILES | C([C@H](C(NCCC(NCCSC(CC(C)(C)O)=O)=O)=O)O)(C)(C)CO |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways