BMCCPUADq017
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1637-39-4 |
| KEGG | C00371 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCPUADq017.mol |
| Zeatin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Zeatin |
| Common Name |
|
| Symbol | |
| Formula | C10H13N5O |
| Exact Mass | 219.112 |
| Average Mass | 219.2433 |
| SMILES | OCC(C)=CCNc(n2)c(n1)c(nc2)nc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
