BMAXTP--0003
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 70-18-8 |
| KEGG | C00051 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXTP--0003.mol |
| Glutathione | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Glutathione |
| Common Name |
|
| Symbol | |
| Formula | C10H17N3O6S |
| Exact Mass | 307.0838 |
| Average Mass | 307.3246 |
| SMILES | OC(=O)CNC(=O)[C@H](CS)NC(=O)CC[C@H](N)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- 2-Amino-acetic acid ⇔ this
- (2S) -2-Amino-5- [ [ (2R) -1-hydroxy-1-oxo-3-sulfanylpropan-2-yl] amino] -5-oxopentanoic acid ⇔ this
- this ⇔ (2S) -2-Amino-pentanedioic acid
- this ⇔ L-Cysteinyl-glycine
- this ⇔ (R) -S-Lactoyl-glutathione
- this ⇔ N1- (g-L-glutamyl-L-cysteinyl-glycyl) -spermidine (2nd)
- this ⇔ S-Formyl-glutathione
- CoA-glutathione ⇔ this
- N1- (g-L-glutamyl-L-cysteinyl-glycyl) -spermidine ⇔ this
