BMACBZ--i009
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 10172-89-1 | 
| KEGG | C05620 | 
| KNApSAcK | |
| CDX file | |
| MOL file | BMACBZ--i009.mol | 
| N-Acetyl-D-phenylalanine | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | N-Acetyl-D-phenylalanine | 
| Common Name | 
  | 
| Symbol | |
| Formula | C11H13NO3 | 
| Exact Mass | 207.0895 | 
| Average Mass | 207.2258 | 
| SMILES | CC(=O)N[C@@H](C(O)=O)Cc(c1)cccc1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
