LBF22406SC01
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0217 |
LipidMaps | LMFA01030178 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF22406SC01.mol |
![]() | |
Structural Information | |
Systematic Name | 7, 10, 13, 16-Docosatetraenoic acid |
Common Name | |
Symbol | |
Formula | C22H36O2 |
Exact Mass | 332.271530396 |
Average Mass | 332.52004000000005 |
SMILES | C(CCC(O)=O)CCC=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in carbon disulfide, heptane and methyl alcohol.<<0292>><<0294>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |