LBF21406CV13
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR8013 | 
| LipidMaps | LMFA03120013 | 
| CAS | |
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | LBF21406CV13.mol | 
| bromovulone I <<8028>> | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | methyl (5Z,7E) -7- [ (R) -4-bromo-2-hydroxy-2- [ (Z) -2-octenyl ] -5-oxo-3-cyclopentenylidene ] -5-heptenoate | 
| Common Name | 
  | 
| Symbol | |
| Formula | C21H29BrO4 | 
| Exact Mass | 424.12492201599997 | 
| Average Mass | 425.35655999999994 | 
| SMILES | C(CC=CC[C@](O)(C(=CC=CCCCC(OC)=O)1)C=C(C1=O)Br)CCC | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | [a]D +6.0°(C 0.05, MeOH)(Yamada Yasuji) | 
| Solubility | Bromovulone I is soluble in MeOH, EtOH, CHCl3, or hexane. | 
| Spectral Information | |
| Mass Spectra | EIMS m/z 424 and 426 (1:1)<<8028>> | 
| UV Spectra | lEtOHmax 247 nm(e12000),312 nm(e12000)<<8028>> | 
| IR Spectra | nmax(CHCl3)3300,1730, 1700, and 1630cm-1<<8028>> | 
| NMR Spectra | 1H-NMR(400MHz,CDCl3)dppm0.89(3H,t,J=7.2Hz),1.30(6H,m),1.80(2H,quint.,J=7.4Hz),1.98(2H,brq,J=7.0Hz),2.36(2H,t,J=7.4Hz),2.42(2H,m),2.66(1H,brdd,J=7.8,14.9Hz),2.81(1H,brdd,J=7.6,14.9Hz),3.69(3H,s),5.22(1H,brtd,J=7.8,11.0Hz),5.55(1H,brtd,J=7.0,11.0Hz),6.11(1H,brtd,J=7.3,10.9Hz),6.77(1H,brdd,J=10.9,12.6Hz),7.35(1H,d,J=12.6Hz),7.43(1H,d,J=0.5Hz).<<8028>> | 
| Chromatograms | |
