LBF20403SC01
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA0215 |
| LipidMaps | LMFA01030176 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20403SC01.mol |
| |
| Structural Information | |
| Systematic Name | 8, 11, 14, 17-Eicosatetraenoic acid / 8, 11, 14, 17-icosatetraenoic acid |
| Common Name | |
| Symbol | |
| Formula | C20H32O2 |
| Exact Mass | 304.240230268 |
| Average Mass | 304.46688 |
| SMILES | C(CC=CCC=CCC=CCCCCCCC(O)=O)=CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in acetone, methyl alcohol and petroleum ether.<<0464>><<0465>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
