LBF20306SC01
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA0197 |
| LipidMaps | LMFA01030158 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20306SC01.mol |
| bishomo-gamma-linolenic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8, 11, 14-Eicosatrienoic acid/8, 11, 14-icosatrienoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H34O2 |
| Exact Mass | 306.255880332 |
| Average Mass | 306.48276000000004 |
| SMILES | C(CC=CCC=CCC=CCCCCCCC(O)=O)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | solubule in CS2, heptane and methylalcohol.<<0292>><<0294>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
