LBF18403SC04
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0209 |
LipidMaps | LMFA01030170 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18403SC04.mol |
alpha-Parinaric acid | |
---|---|
Structural Information | |
Systematic Name | 9, 11, 13, 15-Octadecatetraenoic acid |
Common Name |
|
Symbol | |
Formula | C18H28O2 |
Exact Mass | 276.20893014 |
Average Mass | 276.41372 |
SMILES | CCC=CC=CC=CC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 85 to 86 °C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone, alcohol and petroleum ether.<<0169>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms | Gas liquid chromatogram (provided by Dr. Akiko Horiuchi). |