LBF18305SC02
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0186 |
LipidMaps | LMFA01030147 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18305SC02.mol |
alpha-Eleostearic acid | |
---|---|
Structural Information | |
Systematic Name | cis-9, trans-11, trans-13-Octadecatrienoic acid |
Common Name |
|
Symbol | |
Formula | C18H30O2 |
Exact Mass | 278.224580204 |
Average Mass | 278.4296 |
SMILES | CCCCC=CC=CC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 49-49.2°C |
Boiling Point | 235°C at 15 mmHg |
Density | d504 0.9028 |
Optical Rotation | 1.5112 at 50°C |
Reflactive Index | |
Solubility | soluble in ethanol, cyclohexane and petroleum ether.<<0128>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |