LBF18206SC09
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0163 |
LipidMaps | LMFA01030124 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18206SC09.mol |
Structural Information | |
---|---|
Systematic Name | cis-10, cis-12-Octadecadienoic acid |
Common Name | |
Symbol | |
Formula | C18H32O2 |
Exact Mass | 280.240230268 |
Average Mass | 280.44548000000003 |
SMILES | CCCCCC=CC=CCCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 38.2°C to 39°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | <<0119>><<0252>><<0456>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |