LBF18206SC03
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0151 |
LipidMaps | LMFA01030112 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18206SC03.mol |
Structural Information | |
---|---|
Systematic Name | trans-5, cis12-Octadecadienoic acid |
Common Name | |
Symbol | |
Formula | C18H32O2 |
Exact Mass | 280.240230268 |
Average Mass | 280.44548000000003 |
SMILES | CCCCCC=CCCCCCC=CCCCC(O)=O |
Physicochemical Information | |
Melting Point | -12°C to -9°C |
Boiling Point | 168°C to 170°C at 0.3mmHg |
Density | |
Optical Rotation | 1.4684 at 20°C |
Reflactive Index | |
Solubility | <<0018>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |