LBF18109HP01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8010 |
LipidMaps | LMFA01040011 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18109HP01.mol |
![]() | |
Structural Information | |
Systematic Name | 12,13-Epoxy-11-Hydroperoxy-9-Octadecenoic Acid |
Common Name | |
Symbol | |
Formula | C18H32O5 |
Exact Mass | 328.224974134 |
Average Mass | 328.44368000000003 |
SMILES | O(C1CCCCC)C(C(OO)C=CCCCCCCCC(O)=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methylation, reduction and trimethylsilylation)<<8052/8093>>: m/e= 285[SMTO=CH-CH=CH-(CH2)7COOCH3] |
UV Spectra | |
IR Spectra | After methylation and reduction<<8066/8013/8052>> |
NMR Spectra | 1H-NMR(after methylation and reduction)<<8066/8013/8052>> |
Chromatograms |