LBF18109HO04
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8027 |
LipidMaps | LMFA01050129 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18109HO04.mol |
Structural Information | |
---|---|
Systematic Name | 12,13-Dihydroxy-9-Octadecenoic Acid |
Common Name | |
Symbol | |
Formula | C18H34O4 |
Exact Mass | 314.24570957599997 |
Average Mass | 314.46016 |
SMILES | CCCCCC(O)C(O)CC=CCCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation)<<8059/8071>>: m/e=457[M-CH3], 441[M-OCH3], 382[M-HOTMS], 299[M-173], 275[SMTO=CH-CH(OTMS)-(CH2)4CH3], 185[275-HOTMS], 173[SMTO=CH-( CH2)4CH3],GC-EI-MS(after methanolysis, hydrogenation and trimethylsilylation)<<8059>> |
UV Spectra | |
IR Spectra | Methyl ester<<8071>> |
NMR Spectra | |
Chromatograms |