LBF16401SC02
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0205 |
LipidMaps | LMFA01030166 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF16401SC02.mol |
![]() | |
Structural Information | |
Systematic Name | 6, 9, 12, 15-Hexadesatetraenoic acid |
Common Name | |
Symbol | |
Formula | C16H24O2 |
Exact Mass | 248.17763001199998 |
Average Mass | 248.36056 |
SMILES | C=CCC=CCC=CCC=CCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | 1.4870 at 29°C |
Reflactive Index | |
Solubility | soluble in acetone, alcohol, ether, carbon disuifide and petroleum ether.<<0280>><<0281>><<0508>><<0510>> |
Spectral Information | |
Mass Spectra | ""HR-EI-MS(METHYL ESTER): M/Z; 262.19326(M) EI-MS(PYRROLIDIDE): M/Z; 154,166,194,206,260(M-41), 272(M=29), 286(M-15)EI-MS(PICOLINYL ESTER): M/Z; 339(M), 338(M-1), 324(M-15), 298(M-41), 272, 258, 232, 218, 192 ""<<6002>> |
UV Spectra | |
IR Spectra | |
NMR Spectra | ""CMR(METHYL ESTER): C12, 127.093; C13, 128.939; C14, 31.529; C15, 136.736 C16: 114.741ppm PMR(METHYL ESTER): CH2=CH-C(TERMINAL OLEFINIC PROTON), 4.92-4.96, 5.62-5.88ppm(MULTIPLETS).""<<6001>> |
Chromatograms |