LBF18000OX06
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | DFA0449 |
LipidMaps | LMFA01060065 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18000OX06.mol |
9-Ketostearic acid | |
---|---|
Structural Information | |
Systematic Name | 9-Oxooctadecanoic acid |
Common Name |
|
Symbol | |
Formula | C18H34O3 |
Exact Mass | 298.25079495399996 |
Average Mass | 298.46076 |
SMILES | CCCCCCCCCC(=O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | 83°C |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | easily soluble in acetic acid, ether and hot alcohol / insoluble in water <<0418>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |