BMCCQI--k005
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 2929-14-8 |
KEGG | C05830 |
KNApSAcK | |
CDX file | |
MOL file | BMCCQI--k005.mol |
8-Methoxykynurenate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 8-Methoxy-kynurenic acid |
Common Name |
|
Symbol | |
Formula | C11H9NO4 |
Exact Mass | 219.0531 |
Average Mass | 219.1935 |
SMILES | COc(c2)c(n1)c(cc2)c(O)cc(C(O)=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways
- this ⇔ (S) -2-Amino-4-methylsulfanylbutanoic acid
- this ⇔ 8-Hydroxy-4-oxo-1H-quinoline-2-carboxylic acid