FL6FBBNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=7-Hydroxy-5,4'-dimethoxyflavan |
|Common Name=&&7-Hydroxy-5,4'-dimethoxyflavan&& | |Common Name=&&7-Hydroxy-5,4'-dimethoxyflavan&& | ||
|CAS=103461-94-5 | |CAS=103461-94-5 | ||
|KNApSAcK=C00008756 | |KNApSAcK=C00008756 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 103461-94-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL6FBBNS0001.mol |
7-Hydroxy-5,4'-dimethoxyflavan | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C17H18O4 |
Exact Mass | 286.120509064 |
Average Mass | 286.32241999999997 |
SMILES | COc(c3)ccc(c3)C(C2)Oc(c1)c(C2)c(OC)cc(O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|