FL6F1CNI0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=(+)-4-[6-(1,1-Dimethyl-2-propenyl)-3,4-dihydro-7-hydroxy-2H-1-benzopyran-2-yl]-3,6-bis(3-methyl-2-butenyl)-1,2-benzenediol |
|Common Name=&&Kazinol Q&&(+)-4-[6-(1,1-Dimethyl-2-propenyl)-3,4-dihydro-7-hydroxy-2H-1-benzopyran-2-yl]-3,6-bis(3-methyl-2-butenyl)-1,2-benzenediol&& | |Common Name=&&Kazinol Q&&(+)-4-[6-(1,1-Dimethyl-2-propenyl)-3,4-dihydro-7-hydroxy-2H-1-benzopyran-2-yl]-3,6-bis(3-methyl-2-butenyl)-1,2-benzenediol&& | ||
|CAS=219908-10-8 | |CAS=219908-10-8 | ||
|KNApSAcK=C00013247 | |KNApSAcK=C00013247 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 219908-10-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6F1CNI0003.mol |
| Kazinol Q | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (+)-4-[6-(1,1-Dimethyl-2-propenyl)-3,4-dihydro-7-hydroxy-2H-1-benzopyran-2-yl]-3,6-bis(3-methyl-2-butenyl)-1,2-benzenediol |
| Common Name |
|
| Symbol | |
| Formula | C30H38O4 |
| Exact Mass | 462.27700970399997 |
| Average Mass | 462.62032 |
| SMILES | c(c1CC=C(C)C)(C(O2)CCc(c3)c(cc(c(C(C)(C)C=C)3)O)2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
