FL5FACGA0008
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=??3,5,7,3',4'-Pentahydroxyflavone 3-glucosyl-(1->6)-galactoside |
|Common Name=&&Quercetin 3-glucosyl-(1->6)-galactoside && | |Common Name=&&Quercetin 3-glucosyl-(1->6)-galactoside && | ||
|CAS=90366-14-6 | |CAS=90366-14-6 | ||
|KNApSAcK=C00005399 | |KNApSAcK=C00005399 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 90366-14-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FACGA0008.mol |
| Quercetin 3-glucosyl-(1->6)-galactoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C27H30O17 |
| Exact Mass | 626.148299534 |
| Average Mass | 626.5169000000001 |
| SMILES | c(c(O)5)cc(cc5O)C(O3)=C(C(c(c(O)4)c(cc(O)c4)3)=O)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
